Identification |
Name: | prop-2-enoic acid |
Synonyms: | 2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate |
CAS: | 29862-29-1 |
Molecular Formula: | C3H4O2 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
Molecular Structure: |
|
Properties |
Melting Point: | 12.5 deg C |
Flash Point: | 61.6°C |
Boiling Point: | 141°Cat760mmHg |
Density: | 1.063g/cm3 |
Solubility: | Miscible with alcohol, and ether Miscible with ethanol, ethyl ether; soluble in acetone, benzene, carbon tetrachloride Miscible with chloroform Miscible with water /1X10+6 mg/L/ at 25 deg C |
Flash Point: | 61.6°C |
Color: | Volatile liquid Colorless liquid Colorless liquid or solid (below 55 degrees F) |
Safety Data |
|
|