| Identification |
| Name: | prop-2-enoic acid - tetrachloromethane (1:1) |
| Synonyms: | Acrylic acid, telomer with carbon tetrachloride;Acrylic acid-carbon tetrachloride telomer;Carbon tetrachloride, telomer with acrylic acid;2-Propenoic acid, telomer with tetrachloromethane;Methane, tetrachloro-, telomer with 2-propenic acid;AC1L4HGX;prop-2-enoic acid; tetrachloromethane;LS-123760;28760-34-1 |
| CAS: | 28760-34-1 |
| Molecular Formula: | C4H4Cl4O2 |
| Molecular Weight: | 225.8854 |
| InChI: | InChI=1/C3H4O2.CCl4/c1-2-3(4)5;2-1(3,4)5/h2H,1H2,(H,4,5); |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 61.6°C |
| Boiling Point: | 141°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 61.6°C |
| Safety Data |
| |
 |
