| Identification |
| Name: | Phenazine methosulfate |
| Synonyms: | N-Methylphenazonium methyl sulphate; PMS; 5-methylphenazinium methyl sulphate; Phenazine methosulphate; Phenazine Methoshlphate; N-Methylphenazine methylsulfate salt |
| CAS: | 299-11-6 |
| EINECS: | 206-072-1 |
| Molecular Formula: | C13H11N2?CH3O4S |
| Molecular Weight: | 306.34 |
| InChI: | InChI=1/C13H11N2.CH4O4S/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15;1-5-6(2,3)4/h2-9H,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | soluble |
| Appearance: | yellow crystalline |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Usage: | Used as a an electron carrier in place of the flavine enzyme of warburg in the hexosemonophosphate system: dickens, loc. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
