| Identification | |
| Name: | Phenazine |
| Synonyms: | Phenazine, 98%; Phenazine, 99%; Phenazine Dibenzo[b,e]pyrazine |
| CAS: | 92-82-0 |
| EINECS: | 202-193-9 |
| Molecular Formula: | C12H8N2 |
| Molecular Weight: | 180.21 |
| InChI: | InChI=1/C12H8N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H |
| Molecular Structure: | ![(C12H8N2) Phenazine, 98%; Phenazine, 99%; Phenazine Dibenzo[b,e]pyrazine](https://img.guidechem.com/casimg/92-82-0.gif) |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.25 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | yellow to brown crystalline powder |
| Specification: |
Phenazine (CAS NO.92-82-0) is also named as 5-23-08-00389 (Beilstein Handbook Reference) ; 9,10-Diazaanthracene ; AI3-00065 ; Acridizine ; Azophenylene ; BRN 0126500 ; Dibenzoparadiazine ; Dibenzopyrazine . Phenazine(CAS NO.92-82-0) is yellow to brown crystalline powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
