| Identification | |
| Name: | Acetic acid, oxo-,calcium salt (9CI) |
| Synonyms: | Glyoxylicacid, calcium salt (8CI);Calcium glyoxylate; |
| CAS: | 2990-19-4 |
| EINECS: | 221-059-0 |
| Molecular Formula: | C2H2O3.1/2Ca |
| Molecular Weight: | 113.105 |
| InChI: | InChI=1/C2H2O3.Ca/c3-1-2(4)5;/h1H,(H,4,5);/q;+2/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 98 deg C |
| Density: | 1.384g/cm3 |
| Solubility: | Very soluble in water; slightly soluble in ethanol, ethyl ether, and benzene |
| Color: | Monoclinic crystals from water Rhombic prisms obtained from water with 1/2 mol of water of crystallization. |
| Safety Data | |
 |
|
