| Identification | |
| Name: | Acetic acid, oxo-,sodium salt (9CI) |
| Synonyms: | Glyoxylicacid, sodium salt (8CI);Sodium glyoxylate;Sodium oxoacetate;CCRIS 6298;Acetic acid, oxo-, sodium salt;Glyoxylic acid, sodium salt;Oxoethanoic acid sodium salt;Sodium glyoxylate monohydrate;Glyoxylic acid sodium salt monohydrate; |
| CAS: | 2706-75-4 |
| EINECS: | 220-298-8 |
| Molecular Formula: | C2H2O3.Na |
| Molecular Weight: | 96.02 |
| InChI: | InChI=1/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 98 deg C |
| Density: | 1.384g/cm3 |
| Refractive index: | 1.403 |
| Solubility: | Very soluble in water; slightly soluble in ethanol, ethyl ether, and benzene |
| Storage Temperature: | −20°C |
| Color: | Monoclinic crystals from water Rhombic prisms obtained from water with 1/2 mol of water of crystallization. |
| Safety Data | |
 |
|
