Identification |
Name: | Phenol,2-[(ethylthio)methyl]-, 1-(N-methylcarbamate) |
Synonyms: | Carbamicacid, methyl-, a-(ethylthio)-o-tolylester (8CI);Phenol, 2-[(ethylthio)methyl]-, methylcarbamate (9CI);o-Cresol, a-(ethylthio)-, methylcarbamate(8CI);2-[(Ethylthio)methyl]phenyl methylcarbamate;Arylmate;BAY-HOX 1901;Chox 1901;Croneton;Croneton 500;Ethiofencarb;HOX 1901;a-(Ethylthio)-o-tolylmethylcarbamate; |
CAS: | 29973-13-5 |
EINECS: | 249-981-9 |
Molecular Formula: | C11H15 N O2 S |
Molecular Weight: | 225.33 |
InChI: | InChI=1/C11H15NO2S/c1-3-15-8-9-6-4-5-7-10(9)14-11(13)12-2/h4-7H,3,8H2,1-2H3,(H,12,13) |
Molecular Structure: |
|
Properties |
Melting Point: | 33.4 deg C |
Flash Point: | 151.7°C |
Boiling Point: | 327.3°Cat760mmHg |
Density: | 1.131g/cm3 |
Refractive index: | 1.549 |
Solubility: | In dichloromethane, isopropanol and toluene >200, hexane 5-10 (all in g/l, 20 deg C). In water, 1.82 g/l at 20 deg C |
Specification: |
2-Ethylthiomethylphenyl N-methylcarbamate ,its cas register number is 29973-13-5. It also can be called Ethiofencarb ; 2-[(Ethylsulfanyl)methyl]phenyl-methylcarbamat ; a-Ethylthio-o-tolyl Methylcarbamate ; Dalf dust ; Boruho 50 and Croneton .
|
Flash Point: | 151.7°C |
Color: | Colourless crystals. |
Safety Data |
Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
|
|