| Identification | |
| Name: | Phenol,2-(1-methylpropyl)-, 1-(N-methylcarbamate) |
| Synonyms: | Carbamicacid, methyl-, o-sec-butylphenyl ester (7CI,8CI);Phenol, 2-(1-methylpropyl)-,methylcarbamate (9CI);Phenol, o-sec-butyl-, methylcarbamate (8CI);2-(1-Methylpropyl)phenyl methylcarbamate;2-sec-Butylphenol methylcarbamate;2-sec-Butylphenyl N-methylcarbamate;BASSA;BAY 41637;BPMC;Baktop MC;Barizon;Baycarb;Bipvin;Osbac;Vocktop MC;Zhongdingwei;o-sec-Butylphenyl N-methylcarbamate; |
| CAS: | 3766-81-2 |
| EINECS: | 223-188-8 |
| Molecular Formula: | C12H17NO2 |
| Molecular Weight: | 207.30 |
| InChI: | InChI=1/C12H17NO2/c1-4-9(2)10-7-5-6-8-11(10)15-12(14)13-3/h5-9H,4H2,1-3H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.023 g/cm3 |
| Refractive index: | 1.504 |
| Water Solubility: | solution in water |
| Solubility: | solution in water |
| Appearance: | White crystal |
| Specification: |
Phenol,2-(1-methylpropyl)-, 1-(N-methylcarbamate) , its cas register number is 3766-81-2. It also can be called 2-sek.Butylfenylester kyseliny methylkarbaminove ; Barizon ; Bassa ; Baycarb ; Carvil ; Fenobcarb ; Fenobucarb ; Geocarb 50EC ; Hopcin ; Methylcarbamic acid o-sec-butylphenyl ester ; Osbac ; Phenol, 2-(1-methylpropyl)-, methylcarbamate |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
T: Toxic
F: Flammable
|
 |
|
