| Identification |
| Name: | Ethanol,2-[2-(2-methoxyethoxy)ethoxy]-, 1,1',1''-triester with boric acid (H3BO3) |
| Synonyms: | Ethanol,2-[2-(2-methoxyethoxy)ethoxy]-, triester with boric acid (H3BO3) (8CI,9CI);Triethylene glycol monomethyl ether borate (3:1); Triethylene glycol monomethylether orthoborate; Trimethoxytriglycol orthoborate |
| CAS: | 30989-05-0 |
| EINECS: | 250-418-4 |
| Molecular Formula: | C21H45 B O12 |
| Molecular Weight: | 500.3858 |
| InChI: | InChI=1/C21H45BO12/c1-23-4-7-26-10-13-29-16-19-32-22(33-20-17-30-14-11-27-8-5-24-2)34-21-18-31-15-12-28-9-6-25-3/h4-21H2,1-3H3 |
| Molecular Structure: |
![(C21H45BO12) Ethanol,2-[2-(2-methoxyethoxy)ethoxy]-, triester with boric acid (H3BO3) (8CI,9CI);Triethylene glyco...](https://img1.guidechem.com/chem/e/dict/115/30989-05-0.jpg) |
| Properties |
| Flash Point: | 252.1°C |
| Boiling Point: | 493.3°C at 760 mmHg |
| Density: | 1.056g/cm3 |
| Refractive index: | 1.435 |
| Flash Point: | 252.1°C |
| Safety Data |
| |
 |