Identification |
Name: | 2,6-Octadien-1-ol,3,7-dimethyl-, 1,1',1''-triester with boric acid (H3BO3), (2E,2'E,2''E)- |
Synonyms: | 2,6-Octadien-1-ol,3,7-dimethyl-, triester with boric acid (H3BO3), (2E,2'E,2''E)- (9CI);2,6-Octadien-1-ol, 3,7-dimethyl-, triester with boric acid (H3BO3), (E,E,E)- |
CAS: | 65416-33-3 |
EINECS: | 265-769-9 |
Molecular Formula: | C30H51 B O3 |
Molecular Weight: | 470.5351 |
InChI: | InChI=1/C30H51BO3/c1-25(2)13-10-16-28(7)19-22-32-31(33-23-20-29(8)17-11-14-26(3)4)34-24-21-30(9)18-12-15-27(5)6/h13-15,19-21H,10-12,16-18,22-24H2,1-9H3/b28-19-,29-20-,30-21+ |
Molecular Structure: |
|
Properties |
Flash Point: | 191.2°C |
Boiling Point: | 510.5°Cat760mmHg |
Density: | 0.895g/cm3 |
Refractive index: | 1.479 |
Flash Point: | 191.2°C |
Safety Data |
|
|