Identification |
Name: | Tyrosine,O-(4-hydroxy-3-iodophenyl)-3,5-diiodo- |
Synonyms: | Alanine,3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]-, DL- (8CI); DL-Tyrosine,O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-; 3,3',5-Triiodo-DL-thyronine;3,5,3'-Triiodo-DL-thyronine; DL-Triiodothyronine; Rathyronine |
CAS: | 3130-96-9 |
EINECS: | 221-522-7 |
Molecular Formula: | C15H12 I3 N O4 |
Molecular Weight: | 650.9735 |
InChI: | InChI=1/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22) |
Molecular Structure: |
|
Properties |
Flash Point: | 294.6°C |
Boiling Point: | 563.5°Cat760mmHg |
Density: | 2.387g/cm3 |
Solubility: | In water, 3.958 mg/l at 37 deg C. Soluble in dilute alkalies with the formation of a brownish, water-soluble, sodium salt. Insoluble in propylene glycol. |
Flash Point: | 294.6°C |
Color: | CRYSTALS |
Safety Data |
|
|