Identification |
Name: | D-Tyrosine,O-(4-hydroxy-3-iodophenyl)-3,5-diiodo- |
Synonyms: | Alanine,3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]-, D- (8CI);(+)-Triiodothyronine; 3,3',5-Triiodo-D-thyronine; 3,5,3'-D-Triiodothyronine;3,5,3'-Triiodo-D-thyronine; D-3,5,3'-Triiodothyronine; D-Triiodothyronin;D-Triiodothyronine; DT 3; Detrothyronine; Dextrotriiodothyronine; NSC 46046 |
CAS: | 5714-08-9 |
EINECS: | 227-203-9 |
Molecular Formula: | C15H12 I3 N O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 294.6°C |
Boiling Point: | 563.5°C at 760 mmHg |
Density: | 2.387g/cm3 |
Refractive index: | 1.763 |
Solubility: | In water, 3.958 mg/l at 37 deg C. Soluble in dilute alkalies with the formation of a brownish, water-soluble, sodium salt. Insoluble in propylene glycol. |
Flash Point: | 294.6°C |
Color: | CRYSTALS |
Safety Data |
|
|