| Identification |
| Name: | Carbamic acid,N-[6-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]-, methyl ester |
| Synonyms: | 2-Benzimidazolecarbamicacid, 5-(2-thenoyl)-, methyl ester (8CI);Carbamic acid,[5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]-, methyl ester (9CI);Methyl[5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]carbamate;N-[5-(2-Thenoyl)-2-benzimidazolyl]carbamic acid methyl ester;NSC 238159;Oncodazole;R 17934; |
| CAS: | 31430-18-9 |
| EINECS: | 250-626-5 |
| Molecular Formula: | C14H11N3O3S |
| Molecular Weight: | 301.34 |
| InChI: | InChI=1/C14H11N3O3S/c1-20-14(19)17-13-15-9-5-4-8(7-10(9)16-13)12(18)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16,17,19) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.49 g/cm3 |
| Refractive index: | 1.731 |
| Water Solubility: | DMSO: 10 mg/mL, soluble |
| Solubility: | DMSO: 10 mg/mL, soluble |
| Appearance: | Amber Powder |
| Packinggroup: | III |
| Biological Activity: | Microtubule inhibitor; inhibits mitosis. |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | A synthetic chemotherapeutic agent with antineoplastic, antifungal and anthelmintic activities. Microtubule inhibitor; inhibits mitosis |
| Safety Data |
| Hazard Symbols |
T: Toxic
|
| |
 |
