| Identification | |
| Name: | L-Ornithine L-aspartate salt |
| Synonyms: | Orparan;(2S)-2-amino-4-hydroxy-4-oxobutanoate; [(4S)-4-amino-;L-Ornithine, L-aspartate (1:1);Ornithine, L-, L-aspartate (1:1) (8CI);Aspartic acid compd. with ornithine;Hepamerz;Ormeta;Ornithine aspartate; |
| CAS: | 3230-94-2 |
| EINECS: | 221-772-7 |
| Molecular Formula: | C5H12N2O2 |
| Molecular Weight: | 265.2637 |
| InChI: | InChI=1/C5H12N2O2.C4H7NO4/c6-3-1-2-4(7)5(8)9;5-2(4(8)9)1-3(6)7/h4H,1-3,6-7H2,(H,8,9);2H,1,5H2,(H,6,7)(H,8,9)/p-1/t4-;2-/m00/s1 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | White Powder |
| Specification: |
? L-Ornithine L-aspartate , with CAS number is 3230-94-2, can be called (2S)-2-amino-4-hydroxy-4-oxobutanoate; [(4S)-4-amino-5-hydroxy-5-oxopentyl]azanium ; l-asparticacicompd.withl-ornithine(1:1) ; l-asparticacid,compd.withl-ornithine(1:1);l-asparticacidcompd.withl-ornithine(1:1) ; ormet a; ornithineaspartate; ornithylaspartate ; orparan?;?L-Ornithine L-aspartate salt?.?It is a?white?powder,?L-Ornithine L-Aspartate (CAS NO.3230-94-2) can be used for making amino acid injection in medical treatment of cirrhosis. |
| Color: | white |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
