| Identification |
| Name: | Benzene, 1,1'-oxybis-,pentabromo deriv. |
| Synonyms: | Bromkal G1; DE 60FTM; Pentabromodiphenyl ether; Pentabromodiphenyl oxide; Planelon PB501; Saytex 125 |
| CAS: | 32534-81-9 |
| EINECS: | 251-084-2 |
| Molecular Formula: | C12H5 Br5 O |
| Molecular Weight: | 564.72 |
| InChI: | InChI=1/C12H5Br5O/c13-7-8(14)10(16)12(11(17)9(7)15)18-6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3152 |
| Melting Point: | -7 - -3 oC |
| Density: | 2.343 g/cm3 |
| Stability: | Incompatible with strong oxidizing agents. |
| Refractive index: | 1.681 |
| Water Solubility: | Insoluble ( |
| Solubility: | Insoluble (<0.1 g/100 mLat 20.5 ºC) |
| Appearance: | AMBER VISCOUS LIQUID |
| Packinggroup: | II |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | White crystalline solid |
| Safety Data |
| Hazard Symbols |
|
| |
 |
