| Identification |
| Name: | 2,3-Dichlorotoluene |
| Synonyms: | 2,3-di chloro toluene; 2,3-Dichloro Toluene |
| CAS: | 32768-54-0 |
| EINECS: | 251-203-8 |
| Molecular Formula: | C7H6Cl2 |
| Molecular Weight: | 161.03 |
| InChI: | InChI=1/C7H6Cl2/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.228 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.55-1.552 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
