| Identification | |
| Name: | 2,4-Dichlorotoluene |
| Synonyms: | 2,4-dichloro-1-methylbenzene; 2,4-dichloromethylbenzene; 2,4-DCT |
| CAS: | 95-73-8 |
| EINECS: | 202-445-8 |
| Molecular Formula: | C7H6Cl2 |
| Molecular Weight: | 161.03 |
| InChI: | InChI=1/C7H6Cl2/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.246 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.545-1.547 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | Colorless clear liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless liquid |
| Usage: | High boiling solvent, intermediate for organic synthesis dichlorotoluene. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
