| Identification |
| Name: | Methyl 4-chloroacetoacetate |
| Synonyms: | Methyl 4-chloro-3-oxo-butanoate |
| CAS: | 32807-28-6 |
| EINECS: | 251-230-5 |
| Molecular Formula: | C5H7ClO3 |
| Molecular Weight: | 150.56 |
| InChI: | InChI=1/C5H7ClO3/c1-9-5(8)2-4(7)3-6/h2-3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.287 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.456-1.458 |
| Water Solubility: | 71 g/L (20 oC) |
| Solubility: | 71 g/L (20 ºC) |
| Appearance: | Clear colorless liquid to pale yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
