| Identification |
| Name: | Ethyl 2-chloroacetoacetate |
| Synonyms: | 2-Chloroacetoacetic acid ethyl ester |
| CAS: | 609-15-4 |
| EINECS: | 210-180-4 |
| Molecular Formula: | C6H9ClO3 |
| Molecular Weight: | 164.59 |
| InChI: | InChI=1/C6H9ClO3/c1-3-10-6(9)5(7)4(2)8/h5H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 |
| Density: | 1.19 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.441-1.444 |
| Solubility: | 17 g/L (20 ºC) |
| Appearance: | clear bright yellow liquid |
| Packinggroup: | III |
| HS Code: | 29183000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
