| Identification |
| Name: | 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
| Synonyms: | 2,5-Dihydro-2,5-dimethoxyfuran; 2,5-Dimethoxy-2,5-dihydrofuran |
| CAS: | 332-77-4 |
| EINECS: | 206-367-5 |
| Molecular Formula: | C6H10O3 |
| Molecular Weight: | 130.14 |
| InChI: | InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Melting Point: | <-40°C |
| Density: | 1.073 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.434 |
| Solubility: | Very soluble |
| Appearance: | Clear yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29321900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
