| Identification | |
| Name: | Thiazole,2-chloro-5-methyl- |
| Synonyms: | 2-Chloro-5-methylthiazole; |
| CAS: | 33342-65-3 |
| Molecular Formula: | C4H4ClNS |
| Molecular Weight: | 133.6 |
| InChI: | InChI=1/C4H4ClNS/c1-3-2-6-4(5)7-3/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 76.4°C |
| Boiling Point: | 202.7°Cat760mmHg |
| Density: | 1.331g/cm3 |
| Refractive index: | 1.56 |
| Specification: |
The extinguishing agent of 2-Chloro-5-methylthiazole (CAS NO.33342-65-3) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 76.4°C |
| Safety Data | |
 |
|
