| Identification | |
| Name: | Imazalil nitrate |
| Synonyms: | 1-(2-(2,4-Dichlorophenyl)-2-(2-propenyloxy)ethyl)-1H-imidazole mononitrate |
| CAS: | 33586-66-2 |
| EINECS: | 252-615-0 |
| Molecular Formula: | C14H14Cl2N2O.HNO3 |
| Molecular Weight: | 359.18 |
| InChI: | InChI=1/C14H14Cl2N2O.NO3/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;2-1(3)4/h2-6,8,10,14H,1,7,9H2;/q;-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 52.7 deg C |
| Flash Point: | 225.1°C |
| Boiling Point: | 448.5°Cat760mmHg |
| Density: | 1.23g/cm3 |
| Solubility: | In acetone, dichloromethane, ethanol, methanol, isopropanol, xylene, toluene, benzene > 500g/L at 20 deg C. In hexane 19 g/L at 20 deg C. Also soluble in heptane and petroleum ether. In water, 0.18 g/L at pH 7.6, 20 deg C |
| Flash Point: | 225.1°C |
| Color: | Slightly yellow to brown crystalline mass. Solidified oil Brownish oil |
| Safety Data | |
 |
|
