| Identification | |
| Name: | Imazalil sulfate |
| Synonyms: | 1-[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate (1:1) |
| CAS: | 58594-72-2 |
| EINECS: | 261-351-5 |
| Molecular Formula: | C14H14Cl2N2O.H2SO4 |
| Molecular Weight: | 395.26 |
| InChI: | InChI=1/C14H14Cl2N2O.H2O4S/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;1-5(2,3)4/h2-6,8,10,14H,1,7,9H2;(H2,1,2,3,4) |
| Molecular Structure: | ![(C14H14Cl2N2O.H2SO4) 1-[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate (1:1)](https://img.guidechem.com/casimg/58594-72-2.gif) |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Melting Point: | 52.7 deg C |
| Flash Point: | 225.1°C |
| Boiling Point: | 448.5°Cat760mmHg |
| Density: | 1.23g/cm3 |
| Solubility: | In acetone, dichloromethane, ethanol, methanol, isopropanol, xylene, toluene, benzene > 500g/L at 20 deg C. In hexane 19 g/L at 20 deg C. Also soluble in heptane and petroleum ether. In water, 0.18 g/L at pH 7.6, 20 deg C |
| Appearance: | COA |
| Specification: | Safety Statements:24/25-37-46-60-61 24/25:Avoid contact with skin and eyes 37:Wear suitable gloves 46:If swallowed, seek medical advice immediately and show this container or label 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 225.1°C |
| Color: | Slightly yellow to brown crystalline mass. Solidified oil Brownish oil |
| Safety Data | |
 |
|
