| Identification | |
| Name: | SEC-BUTYLAMINE |
| Synonyms: | (+/-)-2-BUTYLAMINE;2-BUTYLAMINE;(+/-)-1-METHYLPROPYLAMINE;SEC-AMINOBUTANE;S-BUTYLAMINE;SBA;(RS)-S-BUTYLAMINE;(+/-)-ButylamineAminobutane |
| CAS: | 33966-50-6 |
| EINECS: | 237-732-7 |
| Molecular Formula: | C4H11N |
| Molecular Weight: | 73.14 |
| InChI: | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2733 3/PG 2 |
| Melting Point: | −72 °C(lit.) |
| Flash Point: | −3 °F |
| Boiling Point: | 63 °C(lit.) |
| Density: | 0.724 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.3928(lit.) |
| Solubility: | Miscible with most organic solvents Miscible with ethanol, ether; very soluble in acetone In water, 1.12X10+5 mg/L at 20 deg C |
| Packinggroup: | O52 |
| Flash Point: | −3 °F |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
