| Identification | |
| Name: | di-sec-butylamine |
| Synonyms: | Di-sec-butylamine,mixture of (? and meso; Dibutylamine,99% |
| CAS: | 626-23-3 |
| EINECS: | 210-937-9 |
| Molecular Formula: | C8H19N |
| Molecular Weight: | 129.24316 |
| InChI: | InChI=1S/C8H19N/c1-5-7(3)9-8(4)6-2/h7-9H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2733 |
| Melting Point: | -70 C |
| Flash Point: | 69? |
| Density: | 0.753 |
| Stability: | No data. |
| Refractive index: | 1.41 |
| Water Solubility: | slightly soluble (7 g/l), miscible with common organic solvents. |
| Solubility: | slightly soluble (7 g/l), miscible with common organic solvents. |
| Appearance: | clear liquid |
| Specification: | Safety Statements:16-26-27-33-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 33:Take precautionary measures against static discharges 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| HS Code: | 29211980 |
| Flash Point: | 69? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Used as a raw material for herbicides (such as thiocarbazides); pharmaceuticals; corrosion inhibitors; vulcanization accelerators; flotation agents; and dyes. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
