| Identification |
| Name: | 1-Chloro-2-fluorobenzene |
| Synonyms: | ChlorofluorobenzeneChlorofluorobenzene; 2-Chlorofluorobenzene |
| CAS: | 348-51-6 |
| EINECS: | 206-476-8 |
| Molecular Formula: | C6H4ClF |
| Molecular Weight: | 130.55 |
| InChI: | InChI=1/C6H4ClF/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.244 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5-1.502 |
| Solubility: | Insoluble |
| Appearance: | colorless to light brown clear liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
