| Identification |
| Name: | 1-Chloro-3-fluorobenzene |
| Synonyms: | 1-Fluoro-3-chlorobenzene;1-chloro-2-fluoro-benzene;m-Fluorochlorobenzene;m-Chlorofluorobenzene;Benzene, 1-chloro-3-fluoro-;1-chloro-3-fluoro-benzene;3-Fluorochlorobenzene;3-Chlorofluorobenzene; |
| CAS: | 625-98-9 |
| EINECS: | 210-919-0 |
| Molecular Formula: | C6H4ClF |
| Molecular Weight: | 130.547363 |
| InChI: | InChI=1S/C6H4ClF/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.219 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.493-1.495 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | Clear colourless to light yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
| |
 |
