| Identification |
| Name: | PROPRANOLOL HYDROCHLORIDE |
| CAS: | 3506-09-0 |
| EINECS: | 206-268-7 |
| Molecular Formula: | C16H22ClNO2 |
| Molecular Weight: | 309.83096 |
| InChI: | InChI=1S/C17H23NO2.ClH/c1-13(2)10-18-11-15(19)12-20-17-9-5-7-14-6-3-4-8-16(14)17;/h3-9,13,15,18-19H,10-12H2,1-2H3;1H |
| Molecular Structure: |
![(C16H22ClNO2) (RS)-1-[(1-METHYLETHYL)AMINO]-3-(1-NAPHTHALENYLOXY)-2-PROPANOL HYDROCHLORIDE;PROPRANOLOL HCL;(+/-)-P...](https://img.guidechem.com/crawlimg/3506-09-0.png) |
| Properties |
| Transport: | 3249 |
| Flash Point: | 223.6°C |
| Boiling Point: | 446.1°C at 760 mmHg |
| Water Solubility: | H2O: 50 mg/mL, clear, colorless |
| Solubility: | H2O: 50 mg/mL, clear, colorless |
| Appearance: | white powder |
| Packinggroup: | III |
| Biological Activity: | β -adrenergic antagonist. See separate isomers ((R)-(+)-Propranolol hydrochloride and (S)-(-)-Propranolol hydrochloride). |
| Flash Point: | 223.6°C |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Safety Data |
| |
 |