| Identification |
| Name: | 1,4-difluoro-2-nitrobenzene |
| Synonyms: | 2,5-Difluoronitrobenzene |
| CAS: | 364-74-9 |
| EINECS: | 206-663-4 |
| Molecular Formula: | C6H3F2NO2 |
| Molecular Weight: | 159.09 |
| InChI: | InChI=1/C6H3F2NO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2810 |
| Density: | 1.467 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.509(lit.) |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Yellow-green liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
