| Identification |
| Name: | 1H-Imidazole-5-ethanamine,1-methyl-, hydrochloride (1:2) |
| Synonyms: | 1H-Imidazole-5-ethanamine,1-methyl-, dihydrochloride (9CI);2-(1-methyl-1H-imidazol-5-yl)ethanamine dihydrochloride; |
| CAS: | 36475-47-5 |
| Molecular Formula: | C6H13Cl2N3 |
| Molecular Weight: | 198.09 |
| InChI: | InChI=1/C6H11N3.2ClH/c1-9-5-8-4-6(9)2-3-7;;/h4-5H,2-3,7H2,1H3;2*1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 167.5°C |
| Boiling Point: | 353.3°C at 760 mmHg |
| Appearance: | Off-white to pale yellow solid |
| Flash Point: | 167.5°C |
| Storage Temperature: | 2-8°C |
| Usage: | A useful synthetic intermediate in the preparations of farnesyl protein transferase |
| Safety Data |
| |
 |
