Identification |
Name: | 1H-Imidazole-5-ethanamine,1-methyl-, hydrochloride (1:2) |
Synonyms: | 1H-Imidazole-5-ethanamine,1-methyl-, dihydrochloride (9CI);2-(1-methyl-1H-imidazol-5-yl)ethanamine dihydrochloride; |
CAS: | 36475-47-5 |
Molecular Formula: | C6H13Cl2N3 |
Molecular Weight: | 198.09 |
InChI: | InChI=1/C6H11N3.2ClH/c1-9-5-8-4-6(9)2-3-7;;/h4-5H,2-3,7H2,1H3;2*1H |
Molecular Structure: |
|
Properties |
Flash Point: | 167.5°C |
Boiling Point: | 353.3°C at 760 mmHg |
Appearance: | Off-white to pale yellow solid |
Flash Point: | 167.5°C |
Storage Temperature: | 2-8°C |
Usage: | A useful synthetic intermediate in the preparations of farnesyl protein transferase |
Safety Data |
|
|