| Identification | |
| Name: | 1H-Imidazole-1-ethanamine,2-methyl-5-nitro-, hydrochloride (1:2) |
| Synonyms: | 1H-Imidazole-1-ethanamine,2-methyl-5-nitro-, dihydrochloride (9CI); 1-(2-Aminoethyl)-2-methyl-5-nitroimidazoledihydrochloride |
| CAS: | 49575-10-2 |
| EINECS: | 256-385-2 |
| Molecular Formula: | C6H10 N4 O2 . 2 Cl H |
| Molecular Weight: | 261.11 |
| InChI: | InChI=1/C6H10N4O2/c1-5-8-4-6(10(11)12)9(5)3-2-7/h4H,2-3,7H2,1H3/p+1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 195 °C |
| Flash Point: | 181.8°C |
| Boiling Point: | 376.9°Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | off-white crystalline solid |
| Specification: | Off-White Crystalline Solid usageEng:An interesting intermediate in the synthesis of a number of antibacterial and antitumor agents Safety Statements:45-36/37 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 181.8°C |
| Usage: | An interesting intermediate in the synthesis of a number of antibacterial and antitumor agents |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
