| Identification |
| Name: | 2-Fluoro-5-nitroaniline |
| Synonyms: | Fluoronitroaniline1; F03860 2-Fluoro-5-nitroaniline; 2-fluoro-5-nitro aniline; |
| CAS: | 369-36-8 |
| EINECS: | 206-720-3 |
| Molecular Formula: | C6H5FN2O2 |
| Molecular Weight: | 156.11 |
| InChI: | InChI=1/C6H5FN2O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,8H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1325 |
| Boiling Point: | 295.5°Cat760mmHg |
| Density: | 1.448g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | Light brown - ochre - yellow crystalline powder. |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
| |
 |
