| Identification | |
| Name: | 5-Chloro-2-nitroaniline |
| Synonyms: | 5-Chloro-2-nitrobenzeneamine;3-Chloro-6-nitroaniline;Aniline, 5-chloro-2-nitro- (8CI);Aniline, 5-chloro-2-nitro-;Benzenamine, 5-chloro-2-nitro-;2-Nitro-5-chloroaniline;5-chloro-2-nitro-aniline;Benzenamine, 5-chloro-2-nitro- (9CI);5-Chloro-2-nitrobenzenamine;5-chloro-2-nitroanilin; |
| CAS: | 1635-61-6 |
| EINECS: | 216-661-5 |
| Molecular Formula: | C6H5ClN2O2 |
| Molecular Weight: | 172.57 . |
| InChI: | InChI=1S/C6H5ClN2O2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2237 |
| Density: | 1.494g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | 1.2 g/L |
| Appearance: | yellow to orange powder |
| Specification: |
? 5-Chloro-2-nitroaniline (CAS NO.1635-61-6), its Synonyms are 2-Nitro-5-chloroaniline ; 3-Chloro-6-nitroaniline ; 5-Chloro-2-nitrobenzeneamine ; Aniline, 5-chloro-2-nitro- (8CI) ; Benzenamine, 5-chloro-2-nitro- (9CI) . |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols | |
 |
|
