| Identification | |
| Name: | 3-Fluorophenol |
| Synonyms: | Fluorophenolcolorlessliq |
| CAS: | 372-20-3 |
| EINECS: | 206-748-6 |
| Molecular Formula: | C6H5FO |
| Molecular Weight: | 112.1 |
| InChI: | InChI=1/C6H5FO/c7-5-2-1-3-6(8)4-5/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.238 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acid halides. |
| Refractive index: | 1.5125-1.5155 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | colourless to light yellow liquid |
| Specification: |
Hazardous Decomposition Products: Carbon monoxide, carbon dioxide, hydrogen fluoride gas, hydrocarbons, fluorine. |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
