| Identification |
| Name: | 2,6-Difluorobenzoic acid |
| Synonyms: | 2,6-Difluorobonzoicacid;2,6-difluoro benzoic acid;3-09-00-01330 (Beilstein Handbook Reference);Benzoic acid, 2,6-difluoro-;2,6-difluorobenzoate; |
| CAS: | 385-00-2 |
| EINECS: | 206-856-3 |
| Molecular Formula: | C7H4F2O2 |
| Molecular Weight: | 158.1 |
| InChI: | InChI=1/C7H4F2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.432 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | White to light yellow crystal powder |
| HS Code: | 29163900 |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
