| Identification |
| Name: | 3,4-Difluorobenzoic acid |
| Synonyms: | 2,4-difluorobenzoic acid; RARECHEM AL BO 0269; TIMTEC-BB SBB006721; 3,4-Difluorbenzoicacid; Benzoic acid, 3,4-difluoro-; 3,4-Difluorobenzoicacid,98%; 3,4-Difluorobenzoic; 3,4-Difluorobenzoic acid 98% |
| CAS: | 455-86-7 |
| EINECS: | 207-249-6 |
| Molecular Formula: | C7H4F2O2 |
| Molecular Weight: | 158.1 |
| InChI: | InChI=1/C7H4F2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.432 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | slightly soluble in cold water |
| Solubility: | slightly soluble in cold water |
| Appearance: | white to light yellow crystal powder |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
