| Identification | |
| Name: | 2-Nitrobenzyl bromide |
| Synonyms: | alpha-Bromo-2-nitrotoluene; 2-Nitrobenzyl bromide, (a-Bromo-2-nitrotoluene); O-Nitrobenzyl bromide |
| CAS: | 3958-60-9 |
| EINECS: | 223-558-9 |
| Molecular Formula: | C7H6BrNO2 |
| Molecular Weight: | 216.03 |
| InChI: | InChI=1/C7H6BrNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.652 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.611 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Brown crystalline powder. |
| Specification: |
2-Nitrobenzyl bromide , its CAS NO. is 3958-60-9, the synonyms are alpha-Bromo-2-nitrotoluene ; o-Nitrobenzyl bromide ; 1-(Bromomethyl)-2-nitro-benzene . |
| Packinggroup: | II |
| HS Code: | 29049085 |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
