| Identification |
| Name: | 4-Nitrobenzyl bromide |
| Synonyms: | alpha-Bromo-4-nitrotoluene; 4-Nitrobenzyl bromide/a-Bromo-4-Nitrotoluene; 4-Nitrobenzyl bromide,(a-Bromo-4-nitrotoluene); 3,5-Dinitrobenzyl chloride; 1-(Bromomethyl)-4-nitrobenzene; P-Nitrobenzyl bromide |
| CAS: | 100-11-8 |
| EINECS: | 202-820-6 |
| Molecular Formula: | C7H6BrNO2 |
| Molecular Weight: | 216.03 |
| InChI: | InChI=1/C7H6BrNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.652 g/cm3 |
| Stability: | Stable. Incomaptible with bases, amines, oxidizing agents, alcohols. May be moisture sensitive. Corrodes steel. |
| Refractive index: | 1.611 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystalline powder |
| Packinggroup: | II |
| HS Code: | 29049085 |
| Storage Temperature: | Store at RT. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
