Identification |
Name: | 1,2-Eicosanediol |
Synonyms: | icosane-1,2-diol;ARACHIDYL GLYCOL;1,2-Dihydroxy-eicosane;1,2-Eicosanediol |
CAS: | 39825-93-9 |
EINECS: | 254-647-0 |
Molecular Formula: | C20H42 O2 |
Molecular Weight: | 314.54628 |
InChI: | InChI=1/C20H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22)19-21/h20-22H,2-19H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 183.7°C |
Boiling Point: | 435.2°Cat760mmHg |
Density: | 0.888g/cm3 |
Refractive index: | 1.464 |
Flash Point: | 183.7°C |
Usage: | Diols have good antifoaming properties; used for sunscreen, detergent and hair cosmetics |
Safety Data |
|
|