| Identification | |
| Name: | Benzene,2-fluoro-4-methoxy-1-methyl- |
| Synonyms: | Anisole,3-fluoro-4-methyl- (7CI,8CI); 3-Fluoro-4-methylanisole |
| CAS: | 405-06-1 |
| EINECS: | 206-959-3 |
| Molecular Formula: | C8H9 F O |
| Molecular Weight: | 140.15 |
| InChI: | InChI=1/C8H9FO/c1-6-3-4-7(10-2)5-8(6)9/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.123 g/cm3 |
| Refractive index: | 1.475 |
| Water Solubility: | at 25 deg C (mg/L): 9683 |
| Solubility: | at 25 deg C (mg/L): 9683 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
