| Identification | |
| Name: | 5-Acetylthiophene-2-carboxylic acid |
| Synonyms: | 5-Acetyl-2-thiophenecarboxylicacid;5-Carboxy-2-acetylthiophene;Labotest-bb lt00454683;Buttpark 121\06-15;Akos msc-0226;Rarechem al bo 0535; |
| CAS: | 4066-41-5 |
| Molecular Formula: | C7H6O3S |
| Molecular Weight: | 170.19 |
| InChI: | InChI=1/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 186.8 oC |
| Boiling Point: | 385.2 oC at 760 mmHg |
| Density: | 1.383 |
| Refractive index: | 1.591 |
| Specification: | cream to pale brown solid Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Flash Point: | 186.8 oC |
| Safety Data | |
 |
|
