| Identification | |
| Name: | 2,6-Dibromo-benzothiazole |
| Synonyms: | benzothiazole, 2,6-dibromo-;2,6-Dibromobenzothiazole;2,6-Dibromo-1,3-benzothiazole; |
| CAS: | 408328-13-2 |
| Molecular Formula: | C7H3Br2NS |
| Molecular Weight: | 292.98 |
| InChI: | InChI=1/C7H3Br2NS/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.113 g/cm3 |
| Refractive index: | 1.74 |
| Specification: |
The 2,6-Dibromo-benzothiazole with the cas number 408328-13-2, is also called benzothiazole, 2,6-dibromo- .The properties of the 2,6-Dibromo-benzothiazole are: (1)#H bond acceptors: 1 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 0 ; (4)Polar Surface Area: 41.13 Å2 ; (5)Index of Refraction: 1.74 ; (6)Molar Refractivity: 55.95 cm3 ; (7)Molar Volume: 138.6 cm3 ; (8)Polarizability: 22.18×10-24cm3 ; (9)Surface Tension: 62.2 dyne/cm ; (10)Enthalpy of Vaporization: 57.37 kJ/mol ; (11)Vapour Pressure: 7.78×10-5 mmHg at 25°C. This product can be supplied by the following suppliers: (1)BePharm,Ltd.; (2)Capot Chemical Co., Ltd.; (3)Shanghai Chemical Pharm-Intermediate Tech.Co., Ltd.; (4)Modachem Shanghai Co., Ltd. ; (5)PSN Chemical Technology Co., Ltd.; (6)Nanjing Daxian Chemical Institute Ltd.; (7)Ark Pharm, Inc.. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
