Identification |
Name: | 1-Naphthalenol,2-amino-, hydrochloride (1:1) |
Synonyms: | 1-Naphthalenol,2-amino-, hydrochloride (9CI); 1-Naphthol, 2-amino-, hydrochloride (7CI);2-Amino-1-naphthol hydrochloride |
CAS: | 41772-23-0 |
EINECS: | 255-548-5 |
Molecular Formula: | C10H9 N O . Cl H |
Molecular Weight: | 195.66 |
InChI: | InChI=1/C10H9NO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,12H,11H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 161.6°C |
Boiling Point: | 343.5°Cat760mmHg |
Density: | g/cm3 |
Refractive index: | 1.741 |
Specification: |
2-Amino-1-naphthol hydrochloride ,its cas register number is 41772-23-0. It also can be called 1-Naphthalenol, 2-amino-, hydrochloride (1:1) ; 1-Hydroxy-2-naphthylammonium chloride ; and 1-Hydroxy-2-naphthylamine .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 161.6°C |
Safety Data |
|
 |