| Identification |
| Name: | 2-Diisopropylaminoethyl chloride hydrochloride |
| Synonyms: | 2-Chloro-N,N-diisopropylethylamine hydrochloride; 2-Propanamine, N-(2-chloroethyl)-N-(1-methylethyl)-, hydrochloride; DIC hydrochloride; N-(2-Chloroethyl)diisopropylamine hydrochloride; N-(2-chloroethyl)-N-(1-methylethyl)-2-propaneamine,hydrochloride; |
| CAS: | 4261-68-1 |
| EINECS: | 224-238-1 |
| Molecular Formula: | C8H18ClN?HCl |
| Molecular Weight: | 200.15 |
| InChI: | InChI=1/C8H18ClN.ClH/c1-7(2)10(6-5-9)8(3)4;/h7-8H,5-6H2,1-4H3;1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 0.909g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | SOLUBLE |
| Solubility: | H2O: 0.1 g/mL, clear |
| Appearance: | white to yellow crystalline powder |
| Packinggroup: | I |
| HS Code: | 29211980 |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
T+:Verytoxic
C:Corrosive
|
| |
 |
