| Identification |
| Name: | 2-Dimethylaminoisopropyl chloride hydrochloride |
| Synonyms: | 2-Chloro-N,N-dimethylpropylamine hydrochloride; DMIC; 2-Dimethylaminoisopropyl chloride hydrochloride~1-Dimethylamino-2-propyl chloride hydrochloride; 2-Chloro-1-dimethylaminopropane hydrochloride; 2-chloropropyldimethylammonium chloride; N,N-Dimethyl-2-chloropropylamine hydrochloride; 2-Di,ethylaminoisopropyl Chloride Hydrochloride; 2-Chloro-N,N-dimethylpropanamine, Hydrochloride |
| CAS: | 4584-49-0 |
| EINECS: | 224-971-7 |
| Molecular Formula: | C5H12ClN?HCl |
| Molecular Weight: | 158.07 |
| InChI: | InChI=1/C5H12ClN.ClH/c1-5(6)4-7(2)3;/h5H,4H2,1-3H3;1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | 2000 g/L (20 o C) in water |
| Appearance: | white crystal |
| Packinggroup: | III |
| HS Code: | 29211980 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Usage: | 2-Chloro-N,N-dimethylpropylamine hydrochloride (DMIC) is used as intermediate for the syntheses of pharmaceuticals (e.g. isothipendyl, methadone and promethazine) Product Data Sheet |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
