| Identification | |
| Name: | 2-Propanone, 1-fluoro-(8CI,9CI) |
| Synonyms: | 2-Propanone,fluoro- (6CI,7CI); 1-Fluoro-2-propanone; Fluoroacetone; Fluoromethyl methylketone; Monofluoroacetone; NSC 21302; a-Fluoroacetone |
| CAS: | 430-51-3 |
| EINECS: | 207-064-0 |
| Molecular Formula: | C3H5 F O |
| Molecular Weight: | 76.07 |
| InChI: | InChI=1/C3H5FO/c1-3(5)2-4/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2929 6.1/PG 1 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | n20/D 1.37(lit.) |
| Specification: | clear colorless to light yellow liquid Safety Statements:16-36-45 16:Keep away from sources of ignition - No smoking 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
