| Identification | |
| Name: | 2-Propanone, 1-bromo-(8CI,9CI) |
| Synonyms: | 2-Propanone,bromo- (6CI,7CI);1-Bromo-2-propanone;Acetonyl bromide;Acetylmethyl bromide;Bromoacetone;Bromomethyl methyl ketone;Monobromoacetone;a-Bromoacetone;a-Bromopropanone;1-bromopropan-2-one; |
| CAS: | 598-31-2 |
| EINECS: | 209-928-2 |
| Molecular Formula: | C3H5BrO |
| Molecular Weight: | 136.97 |
| InChI: | InChI=1/C3H5BrO/c1-3(5)2-4/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1569 |
| Melting Point: | -36,5°C |
| Flash Point: | 75.3°C |
| Boiling Point: | 137°C |
| Density: | 1.55g/cm3 |
| Refractive index: | 1.449 |
| Solubility: | Sol in alcohol, acetone, ether; slightly soluble in water SOL IN ETHER, BENZENE |
| Appearance: | clear colorless liquid |
| Specification: |
Bromo-2-propanone (598-31-2) also can be called 1-Bromoacetone ; alpha-Bromoacetone ; Acetonyl bromide ; 2-Propanone, 1-bromo- ; 1-Bromo-2-propanone ;and Martonite .It is a clear colorless liquid turning violet on standing, even in the absence of air, and decomposing to a black resinous mass on long standing. Denser than water and poorly soluble in water. Hence sinks in water. A violent lachrymator--low concentrations are very irritating to the eyes; high concentrations or prolonged exposure at lower concentrations may have adverse health effects. Very toxic by inhalation. Contact with the liquid causes painful burns. |
| Packinggroup: | II |
| Flash Point: | 75.3°C |
| Color: | Colorless liquid; rapidly becomes violet even in absence of air |
| Safety Data | |
| Hazard Symbols | |
 |
|
