| Identification | |
| Name: | Propionyl fluoride |
| Synonyms: | - |
| CAS: | 430-71-7 |
| EINECS: | 207-067-7 |
| Molecular Formula: | C3H5FO |
| Molecular Weight: | 76.07 |
| InChI: | InChI=1/C3H5FO/c1-2-3(4)5/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2924 |
| Flash Point: | 3.2°C |
| Boiling Point: | 44°Cat760mmHg |
| Density: | 0.943g/cm3 |
| Refractive index: | 1.323 |
| Specification: | Safety Statements:16-26-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 3.2°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
F: Flammable
|
 |
|
