| Identification | |
| Name: | propionyl chloride |
| Synonyms: | Propanoyl chloride |
| CAS: | 79-03-8 |
| EINECS: | 201-170-0 |
| Molecular Formula: | C3H5ClO |
| Molecular Weight: | 92.52 |
| InChI: | InChI=1/C3H5ClO/c1-2-3(4)5/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1815 |
| Density: | 1.06 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.402-1.405 |
| Water Solubility: | REACTS |
| Solubility: | REACTS in water |
| Appearance: | colorless liquid with a pungent odor |
| Specification: |
?Propionyl chloride (CAS NO.79-03-8), its Synonyms are Propionic acid chloride ; Propionic chloride ; Propanoyl chloride . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29051900 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Usage: | Alkaloid. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
