Identification |
Name: | 2'-Fluoroacetophenone |
Synonyms: | 1-(2-Fluorophenyl)ethanone; Fluoroacetophenone1; Fluoroacetophenonemincolorlessliq; 2-Fluoroacetophenone |
CAS: | 445-27-2 |
EINECS: | 207-156-0 |
Molecular Formula: | C8H7FO |
Molecular Weight: | 138.14 |
InChI: | InChI=1/C8H7FO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 2810 |
Melting Point: | 26-27C |
Density: | 1.137 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.507-1.509 |
Appearance: | Colorless liquid |
HS Code: | 29147090 |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|